C25H20ClN3O3S — CID 134011618
2-(4-chlorophenyl)-N'-[3-(methylsulfinylmethyl)benzoyl]quinoline-4-carbohydrazide (PubChem CID 134011618) has the molecular formula C25H20ClN3O3S and a molecular weight of 477.97 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N'-[3-(methylsulfinylmethyl)benzoyl]quinoline-4-carbohydrazide.
| Compound Name | 2-(4-chlorophenyl)-N'-[3-(methylsulfinylmethyl)benzoyl]quinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 134011618 |
| Molecular Formula | C25H20ClN3O3S |
| Molecular Weight | 477.97 g/mol |
| Exact Mass | 477.09 |
| IUPAC Name | 2-(4-chlorophenyl)-N'-[3-(methylsulfinylmethyl)benzoyl]quinoline-4-carbohydrazide |
| SMILES | CS(=O)Cc1cccc(C(=O)NNC(=O)c2cc(-c3ccc(Cl)cc3)nc3ccccc23)c1 |
| InChI | InChI=1S/C25H20ClN3O3S/c1-33(32)15-16-5-4-6-18(13-16)24(30)28-29-25(31)21-14-23(17-9-11-19(26)12-10-17)27-22-8-3-2-7-20(21)22/h2-14H,15H2,1H3,(H,28,30)(H,29,31) |
| InChIKey | LRBSWKUFCUIJBO-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.97 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|