C27H21ClN4O3 — CID 24540351
N'-(1-acetyl-2,3-dihydroindole-5-carbonyl)-2-(4-chlorophenyl)quinoline-4-carbohydrazide (PubChem CID 24540351) has the molecular formula C27H21ClN4O3 and a molecular weight of 484.94 g/mol. Its IUPAC name is N'-(1-acetyl-2,3-dihydroindole-5-carbonyl)-2-(4-chlorophenyl)quinoline-4-carbohydrazide.
| Compound Name | N'-(1-acetyl-2,3-dihydroindole-5-carbonyl)-2-(4-chlorophenyl)quinoline-4-carbohydrazide |
|---|---|
| PubChem CID | 24540351 |
| Molecular Formula | C27H21ClN4O3 |
| Molecular Weight | 484.94 g/mol |
| Exact Mass | 484.13 |
| IUPAC Name | N'-(1-acetyl-2,3-dihydroindole-5-carbonyl)-2-(4-chlorophenyl)quinoline-4-carbohydrazide |
| SMILES | CC(=O)N1CCc2cc(C(=O)NNC(=O)c3cc(-c4ccc(Cl)cc4)nc4ccccc34)ccc21 |
| InChI | InChI=1S/C27H21ClN4O3/c1-16(33)32-13-12-18-14-19(8-11-25(18)32)26(34)30-31-27(35)22-15-24(17-6-9-20(28)10-7-17)29-23-5-3-2-4-21(22)23/h2-11,14-15H,12-13H2,1H3,(H,30,34)(H,31,35) |
| InChIKey | WREHPJCEXKALMT-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 91.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.94 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|