C29H29N3O2 — CID 3554779
[2-(4-ethylphenyl)quinolin-4-yl]-[4-(2-methoxyphenyl)piperazin-1-yl]methanone (PubChem CID 3554779) has the molecular formula C29H29N3O2 and a molecular weight of 451.57 g/mol. Its IUPAC name is [2-(4-ethylphenyl)quinolin-4-yl]-[4-(2-methoxyphenyl)piperazin-1-yl]methanone.
| Compound Name | [2-(4-ethylphenyl)quinolin-4-yl]-[4-(2-methoxyphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 3554779 |
| Molecular Formula | C29H29N3O2 |
| Molecular Weight | 451.57 g/mol |
| Exact Mass | 451.23 |
| IUPAC Name | [2-(4-ethylphenyl)quinolin-4-yl]-[4-(2-methoxyphenyl)piperazin-1-yl]methanone |
| SMILES | CCc1ccc(-c2cc(C(=O)N3CCN(c4ccccc4OC)CC3)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C29H29N3O2/c1-3-21-12-14-22(15-13-21)26-20-24(23-8-4-5-9-25(23)30-26)29(33)32-18-16-31(17-19-32)27-10-6-7-11-28(27)34-2/h4-15,20H,3,16-19H2,1-2H3 |
| InChIKey | ZRSUSJIMUHFHSO-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.57 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |