C24H26N2O2 — CID 3490109
[2-(4-ethylphenyl)-7,8-dimethylquinolin-4-yl]-morpholin-4-ylmethanone (PubChem CID 3490109) has the molecular formula C24H26N2O2 and a molecular weight of 374.48 g/mol. Its IUPAC name is [2-(4-ethylphenyl)-7,8-dimethylquinolin-4-yl]-morpholin-4-ylmethanone.
| Compound Name | [2-(4-ethylphenyl)-7,8-dimethylquinolin-4-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 3490109 |
| Molecular Formula | C24H26N2O2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | [2-(4-ethylphenyl)-7,8-dimethylquinolin-4-yl]-morpholin-4-ylmethanone |
| SMILES | CCc1ccc(-c2cc(C(=O)N3CCOCC3)c3ccc(C)c(C)c3n2)cc1 |
| InChI | InChI=1S/C24H26N2O2/c1-4-18-6-8-19(9-7-18)22-15-21(24(27)26-11-13-28-14-12-26)20-10-5-16(2)17(3)23(20)25-22/h5-10,15H,4,11-14H2,1-3H3 |
| InChIKey | SXKMDGPYAXKOPG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |