C35H33N3O2 — CID 4080449
(4-benzhydrylpiperazin-1-yl)-[2-(4-methoxyphenyl)-3-methylquinolin-4-yl]methanone (PubChem CID 4080449) has the molecular formula C35H33N3O2 and a molecular weight of 527.67 g/mol. Its IUPAC name is (4-benzhydrylpiperazin-1-yl)-[2-(4-methoxyphenyl)-3-methylquinolin-4-yl]methanone.
| Compound Name | (4-benzhydrylpiperazin-1-yl)-[2-(4-methoxyphenyl)-3-methylquinolin-4-yl]methanone |
|---|---|
| PubChem CID | 4080449 |
| Molecular Formula | C35H33N3O2 |
| Molecular Weight | 527.67 g/mol |
| Exact Mass | 527.26 |
| IUPAC Name | (4-benzhydrylpiperazin-1-yl)-[2-(4-methoxyphenyl)-3-methylquinolin-4-yl]methanone |
| SMILES | COc1ccc(-c2nc3ccccc3c(C(=O)N3CCN(C(c4ccccc4)c4ccccc4)CC3)c2C)cc1 |
| InChI | InChI=1S/C35H33N3O2/c1-25-32(30-15-9-10-16-31(30)36-33(25)26-17-19-29(40-2)20-18-26)35(39)38-23-21-37(22-24-38)34(27-11-5-3-6-12-27)28-13-7-4-8-14-28/h3-20,34H,21-24H2,1-2H3 |
| InChIKey | MURCJNSHBWFSOD-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.67 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |