C26H27N3O4 — CID 46375305
ethyl 1-[2-(4-acetamidophenyl)quinoline-4-carbonyl]piperidine-4-carboxylate (PubChem CID 46375305) has the molecular formula C26H27N3O4 and a molecular weight of 445.52 g/mol. Its IUPAC name is ethyl 1-[2-(4-acetamidophenyl)quinoline-4-carbonyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-(4-acetamidophenyl)quinoline-4-carbonyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 46375305 |
| Molecular Formula | C26H27N3O4 |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | ethyl 1-[2-(4-acetamidophenyl)quinoline-4-carbonyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)c2cc(-c3ccc(NC(C)=O)cc3)nc3ccccc23)CC1 |
| InChI | InChI=1S/C26H27N3O4/c1-3-33-26(32)19-12-14-29(15-13-19)25(31)22-16-24(28-23-7-5-4-6-21(22)23)18-8-10-20(11-9-18)27-17(2)30/h4-11,16,19H,3,12-15H2,1-2H3,(H,27,30) |
| InChIKey | GYNCFGCNKAIHQZ-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |