C28H33N3O2 — CID 39938186
1-[2-(4-methylphenyl)quinoline-4-carbonyl]-N-pentylpiperidine-4-carboxamide (PubChem CID 39938186) has the molecular formula C28H33N3O2 and a molecular weight of 443.59 g/mol. Its IUPAC name is 1-[2-(4-methylphenyl)quinoline-4-carbonyl]-N-pentylpiperidine-4-carboxamide.
| Compound Name | 1-[2-(4-methylphenyl)quinoline-4-carbonyl]-N-pentylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 39938186 |
| Molecular Formula | C28H33N3O2 |
| Molecular Weight | 443.59 g/mol |
| Exact Mass | 443.26 |
| IUPAC Name | 1-[2-(4-methylphenyl)quinoline-4-carbonyl]-N-pentylpiperidine-4-carboxamide |
| SMILES | CCCCCNC(=O)C1CCN(C(=O)c2cc(-c3ccc(C)cc3)nc3ccccc23)CC1 |
| InChI | InChI=1S/C28H33N3O2/c1-3-4-7-16-29-27(32)22-14-17-31(18-15-22)28(33)24-19-26(21-12-10-20(2)11-13-21)30-25-9-6-5-8-23(24)25/h5-6,8-13,19,22H,3-4,7,14-18H2,1-2H3,(H,29,32) |
| InChIKey | XUOFPISGCNPHHH-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.59 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|