C22H31N3O5S — CID 55973426
tert-butyl N-[1-[(E)-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]prop-2-enoyl]piperidin-4-yl]carbamate (PubChem CID 55973426) has the molecular formula C22H31N3O5S and a molecular weight of 449.57 g/mol. Its IUPAC name is tert-butyl N-[1-[(E)-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]prop-2-enoyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[(E)-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]prop-2-enoyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 55973426 |
| Molecular Formula | C22H31N3O5S |
| Molecular Weight | 449.57 g/mol |
| Exact Mass | 449.20 |
| IUPAC Name | tert-butyl N-[1-[(E)-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]prop-2-enoyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(C(=O)/C=C/c2ccc(N3CCCS3(=O)=O)cc2)CC1 |
| InChI | InChI=1S/C22H31N3O5S/c1-22(2,3)30-21(27)23-18-11-14-24(15-12-18)20(26)10-7-17-5-8-19(9-6-17)25-13-4-16-31(25,28)29/h5-10,18H,4,11-16H2,1-3H3,(H,23,27)/b10-7+ |
| InChIKey | QRJBSJLYDAWRFR-JXMROGBWSA-N |
| XLogP | 2.76 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.57 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|