C22H24N2O3S — CID 42937217
(E)-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-1-(2-phenylpyrrolidin-1-yl)prop-2-en-1-one (PubChem CID 42937217) has the molecular formula C22H24N2O3S and a molecular weight of 396.51 g/mol. Its IUPAC name is (E)-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-1-(2-phenylpyrrolidin-1-yl)prop-2-en-1-one.
| Compound Name | (E)-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-1-(2-phenylpyrrolidin-1-yl)prop-2-en-1-one |
|---|---|
| PubChem CID | 42937217 |
| Molecular Formula | C22H24N2O3S |
| Molecular Weight | 396.51 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | (E)-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-1-(2-phenylpyrrolidin-1-yl)prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccc(N2CCCS2(=O)=O)cc1)N1CCCC1c1ccccc1 |
| InChI | InChI=1S/C22H24N2O3S/c25-22(23-15-4-8-21(23)19-6-2-1-3-7-19)14-11-18-9-12-20(13-10-18)24-16-5-17-28(24,26)27/h1-3,6-7,9-14,21H,4-5,8,15-17H2/b14-11+ |
| InChIKey | QUWQWUCQWWHMDS-SDNWHVSQSA-N |
| XLogP | 3.60 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.51 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|