C22H22N2O5S — CID 56548430
methyl 1-[(E)-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]prop-2-enoyl]-2,3-dihydroindole-2-carboxylate (PubChem CID 56548430) has the molecular formula C22H22N2O5S and a molecular weight of 426.49 g/mol. Its IUPAC name is methyl 1-[(E)-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]prop-2-enoyl]-2,3-dihydroindole-2-carboxylate.
| Compound Name | methyl 1-[(E)-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]prop-2-enoyl]-2,3-dihydroindole-2-carboxylate |
|---|---|
| PubChem CID | 56548430 |
| Molecular Formula | C22H22N2O5S |
| Molecular Weight | 426.49 g/mol |
| Exact Mass | 426.12 |
| IUPAC Name | methyl 1-[(E)-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]prop-2-enoyl]-2,3-dihydroindole-2-carboxylate |
| SMILES | COC(=O)C1Cc2ccccc2N1C(=O)/C=C/c1ccc(N2CCCS2(=O)=O)cc1 |
| InChI | InChI=1S/C22H22N2O5S/c1-29-22(26)20-15-17-5-2-3-6-19(17)24(20)21(25)12-9-16-7-10-18(11-8-16)23-13-4-14-30(23,27)28/h2-3,5-12,20H,4,13-15H2,1H3/b12-9+ |
| InChIKey | JBANDLMZBWZMAV-FMIVXFBMSA-N |
| XLogP | 2.37 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.49 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|