C20H26N2O3S — CID 49342808
(E)-N-(dicyclopropylmethyl)-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-N-methylprop-2-enamide (PubChem CID 49342808) has the molecular formula C20H26N2O3S and a molecular weight of 374.51 g/mol. Its IUPAC name is (E)-N-(dicyclopropylmethyl)-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-N-methylprop-2-enamide.
| Compound Name | (E)-N-(dicyclopropylmethyl)-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-N-methylprop-2-enamide |
|---|---|
| PubChem CID | 49342808 |
| Molecular Formula | C20H26N2O3S |
| Molecular Weight | 374.51 g/mol |
| Exact Mass | 374.17 |
| IUPAC Name | (E)-N-(dicyclopropylmethyl)-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-N-methylprop-2-enamide |
| SMILES | CN(C(=O)/C=C/c1ccc(N2CCCS2(=O)=O)cc1)C(C1CC1)C1CC1 |
| InChI | InChI=1S/C20H26N2O3S/c1-21(20(16-6-7-16)17-8-9-17)19(23)12-5-15-3-10-18(11-4-15)22-13-2-14-26(22,24)25/h3-5,10-12,16-17,20H,2,6-9,13-14H2,1H3/b12-5+ |
| InChIKey | SIIXEKMGOVNFCM-LFYBBSHMSA-N |
| XLogP | 2.89 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.51 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|