C23H32N2O3S — CID 55593949
(E)-N-cyclopropyl-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-N-(4-ethylcyclohexyl)prop-2-enamide (PubChem CID 55593949) has the molecular formula C23H32N2O3S and a molecular weight of 416.59 g/mol. Its IUPAC name is (E)-N-cyclopropyl-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-N-(4-ethylcyclohexyl)prop-2-enamide.
| Compound Name | (E)-N-cyclopropyl-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-N-(4-ethylcyclohexyl)prop-2-enamide |
|---|---|
| PubChem CID | 55593949 |
| Molecular Formula | C23H32N2O3S |
| Molecular Weight | 416.59 g/mol |
| Exact Mass | 416.21 |
| IUPAC Name | (E)-N-cyclopropyl-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-N-(4-ethylcyclohexyl)prop-2-enamide |
| SMILES | CCC1CCC(N(C(=O)/C=C/c2ccc(N3CCCS3(=O)=O)cc2)C2CC2)CC1 |
| InChI | InChI=1S/C23H32N2O3S/c1-2-18-4-11-21(12-5-18)25(22-13-14-22)23(26)15-8-19-6-9-20(10-7-19)24-16-3-17-29(24,27)28/h6-10,15,18,21-22H,2-5,11-14,16-17H2,1H3/b15-8+ |
| InChIKey | CHXPVVQTHWMBQS-OVCLIPMQSA-N |
| XLogP | 4.20 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.59 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|