C17H20N2O5S — CID 71899190
[2-(cyclopropylamino)-2-oxoethyl] 3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]prop-2-enoate (PubChem CID 71899190) has the molecular formula C17H20N2O5S and a molecular weight of 364.42 g/mol. Its IUPAC name is [2-(cyclopropylamino)-2-oxoethyl] 3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]prop-2-enoate.
| Compound Name | [2-(cyclopropylamino)-2-oxoethyl] 3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 71899190 |
| Molecular Formula | C17H20N2O5S |
| Molecular Weight | 364.42 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | [2-(cyclopropylamino)-2-oxoethyl] 3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]prop-2-enoate |
| SMILES | O=C(COC(=O)C=Cc1ccc(N2CCCS2(=O)=O)cc1)NC1CC1 |
| InChI | InChI=1S/C17H20N2O5S/c20-16(18-14-5-6-14)12-24-17(21)9-4-13-2-7-15(8-3-13)19-10-1-11-25(19,22)23/h2-4,7-9,14H,1,5-6,10-12H2,(H,18,20) |
| InChIKey | PBDTWSBTVHBPQI-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.42 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|