C18H23N3O4S — CID 55683210
3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-N-(2-oxoazepan-3-yl)prop-2-enamide (PubChem CID 55683210) has the molecular formula C18H23N3O4S and a molecular weight of 377.47 g/mol. Its IUPAC name is 3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-N-(2-oxoazepan-3-yl)prop-2-enamide.
| Compound Name | 3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-N-(2-oxoazepan-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 55683210 |
| Molecular Formula | C18H23N3O4S |
| Molecular Weight | 377.47 g/mol |
| Exact Mass | 377.14 |
| IUPAC Name | 3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-N-(2-oxoazepan-3-yl)prop-2-enamide |
| SMILES | O=C(C=Cc1ccc(N2CCCS2(=O)=O)cc1)NC1CCCCNC1=O |
| InChI | InChI=1S/C18H23N3O4S/c22-17(20-16-4-1-2-11-19-18(16)23)10-7-14-5-8-15(9-6-14)21-12-3-13-26(21,24)25/h5-10,16H,1-4,11-13H2,(H,19,23)(H,20,22) |
| InChIKey | GCNXPUVBKCSRGC-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.47 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|