C22H23N3O4S — CID 35331806
N-[3-[[(E)-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]prop-2-enoyl]amino]phenyl]cyclopropanecarboxamide (PubChem CID 35331806) has the molecular formula C22H23N3O4S and a molecular weight of 425.51 g/mol. Its IUPAC name is N-[3-[[(E)-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]prop-2-enoyl]amino]phenyl]cyclopropanecarboxamide.
| Compound Name | N-[3-[[(E)-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]prop-2-enoyl]amino]phenyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 35331806 |
| Molecular Formula | C22H23N3O4S |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.14 |
| IUPAC Name | N-[3-[[(E)-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]prop-2-enoyl]amino]phenyl]cyclopropanecarboxamide |
| SMILES | O=C(/C=C/c1ccc(N2CCCS2(=O)=O)cc1)Nc1cccc(NC(=O)C2CC2)c1 |
| InChI | InChI=1S/C22H23N3O4S/c26-21(23-18-3-1-4-19(15-18)24-22(27)17-8-9-17)12-7-16-5-10-20(11-6-16)25-13-2-14-30(25,28)29/h1,3-7,10-12,15,17H,2,8-9,13-14H2,(H,23,26)(H,24,27)/b12-7+ |
| InChIKey | ACGKZESMFSRJNM-KPKJPENVSA-N |
| XLogP | 3.23 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|