C20H18N2O3S — CID 46584982
(E)-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-N-(3-ethynylphenyl)prop-2-enamide (PubChem CID 46584982) has the molecular formula C20H18N2O3S and a molecular weight of 366.44 g/mol. Its IUPAC name is (E)-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-N-(3-ethynylphenyl)prop-2-enamide.
| Compound Name | (E)-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-N-(3-ethynylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 46584982 |
| Molecular Formula | C20H18N2O3S |
| Molecular Weight | 366.44 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | (E)-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]-N-(3-ethynylphenyl)prop-2-enamide |
| SMILES | C#Cc1cccc(NC(=O)/C=C/c2ccc(N3CCCS3(=O)=O)cc2)c1 |
| InChI | InChI=1S/C20H18N2O3S/c1-2-16-5-3-6-18(15-16)21-20(23)12-9-17-7-10-19(11-8-17)22-13-4-14-26(22,24)25/h1,3,5-12,15H,4,13-14H2,(H,21,23)/b12-9+ |
| InChIKey | PWAMPTVXEYGPRA-FMIVXFBMSA-N |
| XLogP | 2.86 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.44 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|