C19H17F2N3O4S — CID 56570425
5-[[(E)-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]prop-2-enoyl]amino]-2,4-difluorobenzamide (PubChem CID 56570425) has the molecular formula C19H17F2N3O4S and a molecular weight of 421.43 g/mol. Its IUPAC name is 5-[[(E)-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]prop-2-enoyl]amino]-2,4-difluorobenzamide.
| Compound Name | 5-[[(E)-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]prop-2-enoyl]amino]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 56570425 |
| Molecular Formula | C19H17F2N3O4S |
| Molecular Weight | 421.43 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 5-[[(E)-3-[4-(1,1-dioxo-1,2-thiazolidin-2-yl)phenyl]prop-2-enoyl]amino]-2,4-difluorobenzamide |
| SMILES | NC(=O)c1cc(NC(=O)/C=C/c2ccc(N3CCCS3(=O)=O)cc2)c(F)cc1F |
| InChI | InChI=1S/C19H17F2N3O4S/c20-15-11-16(21)17(10-14(15)19(22)26)23-18(25)7-4-12-2-5-13(6-3-12)24-8-1-9-29(24,27)28/h2-7,10-11H,1,8-9H2,(H2,22,26)(H,23,25)/b7-4+ |
| InChIKey | KZOFQEYNYOMQMU-QPJJXVBHSA-N |
| XLogP | 2.26 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.43 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|