C10H13N2O4- — CID 6928381
(E)-4-oxo-4-[[(3S)-2-oxoazepan-3-yl]amino]but-2-enoate (PubChem CID 6928381) has the molecular formula C10H13N2O4- and a molecular weight of 225.22 g/mol. Its IUPAC name is (E)-4-oxo-4-[[(3S)-2-oxoazepan-3-yl]amino]but-2-enoate.
| Compound Name | (E)-4-oxo-4-[[(3S)-2-oxoazepan-3-yl]amino]but-2-enoate |
|---|---|
| PubChem CID | 6928381 |
| Molecular Formula | C10H13N2O4- |
| Molecular Weight | 225.22 g/mol |
| Exact Mass | 225.09 |
| IUPAC Name | (E)-4-oxo-4-[[(3S)-2-oxoazepan-3-yl]amino]but-2-enoate |
| SMILES | O=C([O-])/C=C/C(=O)N[C@H]1CCCCNC1=O |
| InChI | InChI=1S/C10H14N2O4/c13-8(4-5-9(14)15)12-7-3-1-2-6-11-10(7)16/h4-5,7H,1-3,6H2,(H,11,16)(H,12,13)(H,14,15)/p-1/b5-4+/t7-/m0/s1 |
| InChIKey | FRJXIXDOYXQZRB-KPJROHGDSA-M |
| XLogP | -1.92 |
| TPSA | 98.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.22 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|