C13H23N3O2 — CID 43704094
1-amino-N-(2-oxoazepan-3-yl)cyclohexane-1-carboxamide (PubChem CID 43704094) has the molecular formula C13H23N3O2 and a molecular weight of 253.35 g/mol. Its IUPAC name is 1-amino-N-(2-oxoazepan-3-yl)cyclohexane-1-carboxamide.
| Compound Name | 1-amino-N-(2-oxoazepan-3-yl)cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 43704094 |
| Molecular Formula | C13H23N3O2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.18 |
| IUPAC Name | 1-amino-N-(2-oxoazepan-3-yl)cyclohexane-1-carboxamide |
| SMILES | NC1(C(=O)NC2CCCCNC2=O)CCCCC1 |
| InChI | InChI=1S/C13H23N3O2/c14-13(7-3-1-4-8-13)12(18)16-10-6-2-5-9-15-11(10)17/h10H,1-9,14H2,(H,15,17)(H,16,18) |
| InChIKey | PSDVZRCLIVPJIA-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |