C9H15N3O2 — CID 65466237
1-amino-N-(2-oxopiperidin-3-yl)cyclopropane-1-carboxamide (PubChem CID 65466237) has the molecular formula C9H15N3O2 and a molecular weight of 197.24 g/mol. Its IUPAC name is 1-amino-N-(2-oxopiperidin-3-yl)cyclopropane-1-carboxamide.
| Compound Name | 1-amino-N-(2-oxopiperidin-3-yl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 65466237 |
| Molecular Formula | C9H15N3O2 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 1-amino-N-(2-oxopiperidin-3-yl)cyclopropane-1-carboxamide |
| SMILES | NC1(C(=O)NC2CCCNC2=O)CC1 |
| InChI | InChI=1S/C9H15N3O2/c10-9(3-4-9)8(14)12-6-2-1-5-11-7(6)13/h6H,1-5,10H2,(H,11,13)(H,12,14) |
| InChIKey | HYUWMEUUHPLZLX-UHFFFAOYSA-N |
| XLogP | -1.13 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | -1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |