C19H33N3O4 — CID 108916112
tert-butyl N-[2-oxo-2-[4-[(E)-3,4,4-trimethylpent-2-enoyl]piperazin-1-yl]ethyl]carbamate (PubChem CID 108916112) has the molecular formula C19H33N3O4 and a molecular weight of 367.49 g/mol. Its IUPAC name is tert-butyl N-[2-oxo-2-[4-[(E)-3,4,4-trimethylpent-2-enoyl]piperazin-1-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-oxo-2-[4-[(E)-3,4,4-trimethylpent-2-enoyl]piperazin-1-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 108916112 |
| Molecular Formula | C19H33N3O4 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | tert-butyl N-[2-oxo-2-[4-[(E)-3,4,4-trimethylpent-2-enoyl]piperazin-1-yl]ethyl]carbamate |
| SMILES | C/C(=C\C(=O)N1CCN(C(=O)CNC(=O)OC(C)(C)C)CC1)C(C)(C)C |
| InChI | InChI=1S/C19H33N3O4/c1-14(18(2,3)4)12-15(23)21-8-10-22(11-9-21)16(24)13-20-17(25)26-19(5,6)7/h12H,8-11,13H2,1-7H3,(H,20,25)/b14-12+ |
| InChIKey | SVFIRFSBCCZCHJ-WYMLVPIESA-N |
| XLogP | 2.17 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|