C15H16ClNO2S — CID 113102822
N-[2-(2-chloro-5-methylphenoxy)ethyl]-2-thiophen-2-ylacetamide (PubChem CID 113102822) has the molecular formula C15H16ClNO2S and a molecular weight of 309.82 g/mol. Its IUPAC name is N-[2-(2-chloro-5-methylphenoxy)ethyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[2-(2-chloro-5-methylphenoxy)ethyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 113102822 |
| Molecular Formula | C15H16ClNO2S |
| Molecular Weight | 309.82 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | N-[2-(2-chloro-5-methylphenoxy)ethyl]-2-thiophen-2-ylacetamide |
| SMILES | Cc1ccc(Cl)c(OCCNC(=O)Cc2cccs2)c1 |
| InChI | InChI=1S/C15H16ClNO2S/c1-11-4-5-13(16)14(9-11)19-7-6-17-15(18)10-12-3-2-8-20-12/h2-5,8-9H,6-7,10H2,1H3,(H,17,18) |
| InChIKey | GQPYSIRQMTXKNH-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.82 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|