C16H19NO4S — CID 113102045
N-[2-(3,5-dimethoxyphenoxy)ethyl]-2-thiophen-2-ylacetamide (PubChem CID 113102045) has the molecular formula C16H19NO4S and a molecular weight of 321.40 g/mol. Its IUPAC name is N-[2-(3,5-dimethoxyphenoxy)ethyl]-2-thiophen-2-ylacetamide.
| Compound Name | N-[2-(3,5-dimethoxyphenoxy)ethyl]-2-thiophen-2-ylacetamide |
|---|---|
| PubChem CID | 113102045 |
| Molecular Formula | C16H19NO4S |
| Molecular Weight | 321.40 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | N-[2-(3,5-dimethoxyphenoxy)ethyl]-2-thiophen-2-ylacetamide |
| SMILES | COc1cc(OC)cc(OCCNC(=O)Cc2cccs2)c1 |
| InChI | InChI=1S/C16H19NO4S/c1-19-12-8-13(20-2)10-14(9-12)21-6-5-17-16(18)11-15-4-3-7-22-15/h3-4,7-10H,5-6,11H2,1-2H3,(H,17,18) |
| InChIKey | ZQABNFGFRIXOAQ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.40 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|