C19H13Cl2N3O7 — CID 108746345
methyl 3-(2,6-dichlorophenyl)-5-[[2-(4-nitrophenoxy)acetyl]amino]-1,2-oxazole-4-carboxylate (PubChem CID 108746345) has the molecular formula C19H13Cl2N3O7 and a molecular weight of 466.23 g/mol. Its IUPAC name is methyl 3-(2,6-dichlorophenyl)-5-[[2-(4-nitrophenoxy)acetyl]amino]-1,2-oxazole-4-carboxylate.
| Compound Name | methyl 3-(2,6-dichlorophenyl)-5-[[2-(4-nitrophenoxy)acetyl]amino]-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 108746345 |
| Molecular Formula | C19H13Cl2N3O7 |
| Molecular Weight | 466.23 g/mol |
| Exact Mass | 465.01 |
| IUPAC Name | methyl 3-(2,6-dichlorophenyl)-5-[[2-(4-nitrophenoxy)acetyl]amino]-1,2-oxazole-4-carboxylate |
| SMILES | COC(=O)c1c(-c2c(Cl)cccc2Cl)noc1NC(=O)COc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C19H13Cl2N3O7/c1-29-19(26)16-17(15-12(20)3-2-4-13(15)21)23-31-18(16)22-14(25)9-30-11-7-5-10(6-8-11)24(27)28/h2-8H,9H2,1H3,(H,22,25) |
| InChIKey | NQUOECNWWWOFOS-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 133.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.23 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|