C14H17N3O4 — CID 104682580
2-methyl-5-[(3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-carbonyl)amino]pentanoic acid (PubChem CID 104682580) has the molecular formula C14H17N3O4 and a molecular weight of 291.31 g/mol. Its IUPAC name is 2-methyl-5-[(3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-carbonyl)amino]pentanoic acid.
| Compound Name | 2-methyl-5-[(3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-carbonyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 104682580 |
| Molecular Formula | C14H17N3O4 |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | 2-methyl-5-[(3-methyl-[1,2]oxazolo[5,4-b]pyridine-5-carbonyl)amino]pentanoic acid |
| SMILES | Cc1noc2ncc(C(=O)NCCCC(C)C(=O)O)cc12 |
| InChI | InChI=1S/C14H17N3O4/c1-8(14(19)20)4-3-5-15-12(18)10-6-11-9(2)17-21-13(11)16-7-10/h6-8H,3-5H2,1-2H3,(H,15,18)(H,19,20) |
| InChIKey | KPIKPBBNHZDVRZ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 105.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|