C9H10N4O — CID 126986999
N-(cyanomethyl)-6-(methylamino)pyridine-3-carboxamide (PubChem CID 126986999) has the molecular formula C9H10N4O and a molecular weight of 190.21 g/mol. Its IUPAC name is N-(cyanomethyl)-6-(methylamino)pyridine-3-carboxamide.
| Compound Name | N-(cyanomethyl)-6-(methylamino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 126986999 |
| Molecular Formula | C9H10N4O |
| Molecular Weight | 190.21 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | N-(cyanomethyl)-6-(methylamino)pyridine-3-carboxamide |
| SMILES | CNc1ccc(C(=O)NCC#N)cn1 |
| InChI | InChI=1S/C9H10N4O/c1-11-8-3-2-7(6-13-8)9(14)12-5-4-10/h2-3,6H,5H2,1H3,(H,11,13)(H,12,14) |
| InChIKey | CBJLRZCSQMDEGN-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 77.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.21 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|