C13H17N5O2 — CID 83179327
ethyl 4-methyl-2-(2-pyrazol-1-ylethylamino)pyrimidine-5-carboxylate (PubChem CID 83179327) has the molecular formula C13H17N5O2 and a molecular weight of 275.31 g/mol. Its IUPAC name is ethyl 4-methyl-2-(2-pyrazol-1-ylethylamino)pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-methyl-2-(2-pyrazol-1-ylethylamino)pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 83179327 |
| Molecular Formula | C13H17N5O2 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | ethyl 4-methyl-2-(2-pyrazol-1-ylethylamino)pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(NCCn2cccn2)nc1C |
| InChI | InChI=1S/C13H17N5O2/c1-3-20-12(19)11-9-15-13(17-10(11)2)14-6-8-18-7-4-5-16-18/h4-5,7,9H,3,6,8H2,1-2H3,(H,14,15,17) |
| InChIKey | QDYVTFQBGSDKAH-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |