C19H14N4O2S — CID 121167812
N-(1,3-benzothiazol-2-yl)-6-phenylmethoxypyrimidine-4-carboxamide (PubChem CID 121167812) has the molecular formula C19H14N4O2S and a molecular weight of 362.41 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-6-phenylmethoxypyrimidine-4-carboxamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-6-phenylmethoxypyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 121167812 |
| Molecular Formula | C19H14N4O2S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.08 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-6-phenylmethoxypyrimidine-4-carboxamide |
| SMILES | O=C(Nc1nc2ccccc2s1)c1cc(OCc2ccccc2)ncn1 |
| InChI | InChI=1S/C19H14N4O2S/c24-18(23-19-22-14-8-4-5-9-16(14)26-19)15-10-17(21-12-20-15)25-11-13-6-2-1-3-7-13/h1-10,12H,11H2,(H,22,23,24) |
| InChIKey | UKYTVMUGOABIAG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |