About 2-oxo-N-(1,3-thiazol-2-yl)-1-[[4-(trifluoromethyl)phenyl]methoxy]pyridine-3-carboxamide
2-oxo-N-(1,3-thiazol-2-yl)-1-[[4-(trifluoromethyl)phenyl]methoxy]pyridine-3-carboxamide (PubChem CID 110382882) has the molecular formula C17H12F3N3O3S
and a molecular weight of 395.36 g/mol. Its IUPAC name is 2-oxo-N-(1,3-thiazol-2-yl)-1-[[4-(trifluoromethyl)phenyl]methoxy]pyridine-3-carboxamide.
Molecular Properties
| Compound Name | 2-oxo-N-(1,3-thiazol-2-yl)-1-[[4-(trifluoromethyl)phenyl]methoxy]pyridine-3-carboxamide |
| PubChem CID | 110382882 |
| Molecular Formula | C17H12F3N3O3S |
| Molecular Weight | 395.36 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 2-oxo-N-(1,3-thiazol-2-yl)-1-[[4-(trifluoromethyl)phenyl]methoxy]pyridine-3-carboxamide |
| SMILES | O=C(Nc1nccs1)c1cccn(OCc2ccc(C(F)(F)F)cc2)c1=O |
| InChI | InChI=1S/C17H12F3N3O3S/c18-17(19,20)12-5-3-11(4-6-12)10-26-23-8-1-2-13(15(23)25)14(24)22-16-21-7-9-27-16/h1-9H,10H2,(H,21,22,24) |
| InChIKey | CQKQRWLWSMKEKF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-oxo-N-(1,3-thiazol-2-yl)-1-[[4-(trifluoromethyl)phenyl]methoxy]pyridine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxo-N-(1,3-thiazol-2-yl)-1-[[4-(trifluoromethyl)phenyl]methoxy]pyridine-3-carboxamide?
The IUPAC name of 2-oxo-N-(1,3-thiazol-2-yl)-1-[[4-(trifluoromethyl)phenyl]methoxy]pyridine-3-carboxamide (CID 110382882) is 2-oxo-N-(1,3-thiazol-2-yl)-1-[[4-(trifluoromethyl)phenyl]methoxy]pyridine-3-carboxamide.
What is the SMILES notation for 2-oxo-N-(1,3-thiazol-2-yl)-1-[[4-(trifluoromethyl)phenyl]methoxy]pyridine-3-carboxamide?
The canonical SMILES for 2-oxo-N-(1,3-thiazol-2-yl)-1-[[4-(trifluoromethyl)phenyl]methoxy]pyridine-3-carboxamide is O=C(Nc1nccs1)c1cccn(OCc2ccc(C(F)(F)F)cc2)c1=O.
What is the InChIKey of 2-oxo-N-(1,3-thiazol-2-yl)-1-[[4-(trifluoromethyl)phenyl]methoxy]pyridine-3-carboxamide?
The InChIKey is CQKQRWLWSMKEKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12F3N3O3S/c18-17(19,20)12-5-3-11(4-6-12)10-26-23-8-1-2-13(15(23)25)14(24)22-16-21-7-9-27-16/h1-9H,10H2,(H,21,22,24).
What are the key properties of 2-oxo-N-(1,3-thiazol-2-yl)-1-[[4-(trifluoromethyl)phenyl]methoxy]pyridine-3-carboxamide?
2-oxo-N-(1,3-thiazol-2-yl)-1-[[4-(trifluoromethyl)phenyl]methoxy]pyridine-3-carboxamide has a molecular weight of 395.36 g/mol, XLogP of 3.20, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxo-N-(1,3-thiazol-2-yl)-1-[[4-(trifluoromethyl)phenyl]methoxy]pyridine-3-carboxamide is sourced from PubChem (CID 110382882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).