C13H14N4O3S3 — CID 100595501
2-(methanesulfonamido)-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide (PubChem CID 100595501) has the molecular formula C13H14N4O3S3 and a molecular weight of 370.48 g/mol. Its IUPAC name is 2-(methanesulfonamido)-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide.
| Compound Name | 2-(methanesulfonamido)-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide |
|---|---|
| PubChem CID | 100595501 |
| Molecular Formula | C13H14N4O3S3 |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.02 |
| IUPAC Name | 2-(methanesulfonamido)-N-(5-prop-2-enylsulfanyl-1,3,4-thiadiazol-2-yl)benzamide |
| SMILES | C=CCSc1nnc(NC(=O)c2ccccc2NS(C)(=O)=O)s1 |
| InChI | InChI=1S/C13H14N4O3S3/c1-3-8-21-13-16-15-12(22-13)14-11(18)9-6-4-5-7-10(9)17-23(2,19)20/h3-7,17H,1,8H2,2H3,(H,14,15,18) |
| InChIKey | UICCOPGFEUSKNP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|