C13H11ClF3N3OS2 — CID 4985315
2-chloro-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(trifluoromethyl)benzamide (PubChem CID 4985315) has the molecular formula C13H11ClF3N3OS2 and a molecular weight of 381.83 g/mol. Its IUPAC name is 2-chloro-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(trifluoromethyl)benzamide.
| Compound Name | 2-chloro-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 4985315 |
| Molecular Formula | C13H11ClF3N3OS2 |
| Molecular Weight | 381.83 g/mol |
| Exact Mass | 381.00 |
| IUPAC Name | 2-chloro-N-(5-propylsulfanyl-1,3,4-thiadiazol-2-yl)-3-(trifluoromethyl)benzamide |
| SMILES | CCCSc1nnc(NC(=O)c2cccc(C(F)(F)F)c2Cl)s1 |
| InChI | InChI=1S/C13H11ClF3N3OS2/c1-2-6-22-12-20-19-11(23-12)18-10(21)7-4-3-5-8(9(7)14)13(15,16)17/h3-5H,2,6H2,1H3,(H,18,19,21) |
| InChIKey | DRJFEAZZHZIELV-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.83 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|