C13H13ClN4O3S2 — CID 17319707
N-(5-butan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)-2-chloro-4-nitrobenzamide (PubChem CID 17319707) has the molecular formula C13H13ClN4O3S2 and a molecular weight of 372.86 g/mol. Its IUPAC name is N-(5-butan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)-2-chloro-4-nitrobenzamide.
| Compound Name | N-(5-butan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)-2-chloro-4-nitrobenzamide |
|---|---|
| PubChem CID | 17319707 |
| Molecular Formula | C13H13ClN4O3S2 |
| Molecular Weight | 372.86 g/mol |
| Exact Mass | 372.01 |
| IUPAC Name | N-(5-butan-2-ylsulfanyl-1,3,4-thiadiazol-2-yl)-2-chloro-4-nitrobenzamide |
| SMILES | CCC(C)Sc1nnc(NC(=O)c2ccc([N+](=O)[O-])cc2Cl)s1 |
| InChI | InChI=1S/C13H13ClN4O3S2/c1-3-7(2)22-13-17-16-12(23-13)15-11(19)9-5-4-8(18(20)21)6-10(9)14/h4-7H,3H2,1-2H3,(H,15,16,19) |
| InChIKey | YOCAAZXWUGBTSD-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.86 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|