C14H11N7O5S — CID 4314898
[2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl] 2-(5-phenyltetrazol-2-yl)acetate (PubChem CID 4314898) has the molecular formula C14H11N7O5S and a molecular weight of 389.35 g/mol. Its IUPAC name is [2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl] 2-(5-phenyltetrazol-2-yl)acetate.
| Compound Name | [2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl] 2-(5-phenyltetrazol-2-yl)acetate |
|---|---|
| PubChem CID | 4314898 |
| Molecular Formula | C14H11N7O5S |
| Molecular Weight | 389.35 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | [2-[(5-nitro-1,3-thiazol-2-yl)amino]-2-oxoethyl] 2-(5-phenyltetrazol-2-yl)acetate |
| SMILES | O=C(COC(=O)Cn1nnc(-c2ccccc2)n1)Nc1ncc([N+](=O)[O-])s1 |
| InChI | InChI=1S/C14H11N7O5S/c22-10(16-14-15-6-11(27-14)21(24)25)8-26-12(23)7-20-18-13(17-19-20)9-4-2-1-3-5-9/h1-6H,7-8H2,(H,15,16,22) |
| InChIKey | OFCRRJVKFLBNNZ-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 155.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.35 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|