C26H22N2O6 — CID 4784475
[2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] 3-(2-methoxyanilino)propanoate (PubChem CID 4784475) has the molecular formula C26H22N2O6 and a molecular weight of 458.47 g/mol. Its IUPAC name is [2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] 3-(2-methoxyanilino)propanoate.
| Compound Name | [2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] 3-(2-methoxyanilino)propanoate |
|---|---|
| PubChem CID | 4784475 |
| Molecular Formula | C26H22N2O6 |
| Molecular Weight | 458.47 g/mol |
| Exact Mass | 458.15 |
| IUPAC Name | [2-[(9,10-dioxoanthracen-2-yl)amino]-2-oxoethyl] 3-(2-methoxyanilino)propanoate |
| SMILES | COc1ccccc1NCCC(=O)OCC(=O)Nc1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C26H22N2O6/c1-33-22-9-5-4-8-21(22)27-13-12-24(30)34-15-23(29)28-16-10-11-19-20(14-16)26(32)18-7-3-2-6-17(18)25(19)31/h2-11,14,27H,12-13,15H2,1H3,(H,28,29) |
| InChIKey | NGWOITXYPIDYTP-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.47 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|