C11H11NO — CID 155920718
3-ethynyl-N,5-dimethylbenzamide (PubChem CID 155920718) has the molecular formula C11H11NO and a molecular weight of 173.21 g/mol. Its IUPAC name is 3-ethynyl-N,5-dimethylbenzamide.
| Compound Name | 3-ethynyl-N,5-dimethylbenzamide |
|---|---|
| PubChem CID | 155920718 |
| Molecular Formula | C11H11NO |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.08 |
| IUPAC Name | 3-ethynyl-N,5-dimethylbenzamide |
| SMILES | C#Cc1cc(C)cc(C(=O)NC)c1 |
| InChI | InChI=1S/C11H11NO/c1-4-9-5-8(2)6-10(7-9)11(13)12-3/h1,5-7H,2-3H3,(H,12,13) |
| InChIKey | NFOZTQQHOUXGDM-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|