C32H31N3O4 — CID 4513398
4-tert-butyl-N-[4-[[[2-(4-phenylphenoxy)acetyl]amino]carbamoyl]phenyl]benzamide (PubChem CID 4513398) has the molecular formula C32H31N3O4 and a molecular weight of 521.62 g/mol. Its IUPAC name is 4-tert-butyl-N-[4-[[[2-(4-phenylphenoxy)acetyl]amino]carbamoyl]phenyl]benzamide.
| Compound Name | 4-tert-butyl-N-[4-[[[2-(4-phenylphenoxy)acetyl]amino]carbamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 4513398 |
| Molecular Formula | C32H31N3O4 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | 4-tert-butyl-N-[4-[[[2-(4-phenylphenoxy)acetyl]amino]carbamoyl]phenyl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)Nc2ccc(C(=O)NNC(=O)COc3ccc(-c4ccccc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C32H31N3O4/c1-32(2,3)26-15-9-24(10-16-26)30(37)33-27-17-11-25(12-18-27)31(38)35-34-29(36)21-39-28-19-13-23(14-20-28)22-7-5-4-6-8-22/h4-20H,21H2,1-3H3,(H,33,37)(H,34,36)(H,35,38) |
| InChIKey | YVJMVVXOYORTMU-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|