C19H23Cl2NO2 — CID 3677320
N-[2-(1-adamantyloxy)ethyl]-3,4-dichlorobenzamide (PubChem CID 3677320) has the molecular formula C19H23Cl2NO2 and a molecular weight of 368.30 g/mol. Its IUPAC name is N-[2-(1-adamantyloxy)ethyl]-3,4-dichlorobenzamide.
| Compound Name | N-[2-(1-adamantyloxy)ethyl]-3,4-dichlorobenzamide |
|---|---|
| PubChem CID | 3677320 |
| Molecular Formula | C19H23Cl2NO2 |
| Molecular Weight | 368.30 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | N-[2-(1-adamantyloxy)ethyl]-3,4-dichlorobenzamide |
| SMILES | O=C(NCCOC12CC3CC(CC(C3)C1)C2)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C19H23Cl2NO2/c20-16-2-1-15(8-17(16)21)18(23)22-3-4-24-19-9-12-5-13(10-19)7-14(6-12)11-19/h1-2,8,12-14H,3-7,9-11H2,(H,22,23) |
| InChIKey | AIPQYICVKVIXOV-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.30 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|