C17H19ClN4O2S — CID 16948749
1-[4-(azepane-1-carbonyl)-1,3-thiazol-2-yl]-3-(3-chlorophenyl)urea (PubChem CID 16948749) has the molecular formula C17H19ClN4O2S and a molecular weight of 378.89 g/mol. Its IUPAC name is 1-[4-(azepane-1-carbonyl)-1,3-thiazol-2-yl]-3-(3-chlorophenyl)urea.
| Compound Name | 1-[4-(azepane-1-carbonyl)-1,3-thiazol-2-yl]-3-(3-chlorophenyl)urea |
|---|---|
| PubChem CID | 16948749 |
| Molecular Formula | C17H19ClN4O2S |
| Molecular Weight | 378.89 g/mol |
| Exact Mass | 378.09 |
| IUPAC Name | 1-[4-(azepane-1-carbonyl)-1,3-thiazol-2-yl]-3-(3-chlorophenyl)urea |
| SMILES | O=C(Nc1cccc(Cl)c1)Nc1nc(C(=O)N2CCCCCC2)cs1 |
| InChI | InChI=1S/C17H19ClN4O2S/c18-12-6-5-7-13(10-12)19-16(24)21-17-20-14(11-25-17)15(23)22-8-3-1-2-4-9-22/h5-7,10-11H,1-4,8-9H2,(H2,19,20,21,24) |
| InChIKey | CJLNZRRLLWZTMI-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.89 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |