C18H22N4O2S — CID 16948435
1-[4-(azepane-1-carbonyl)-1,3-thiazol-2-yl]-3-(3-methylphenyl)urea (PubChem CID 16948435) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is 1-[4-(azepane-1-carbonyl)-1,3-thiazol-2-yl]-3-(3-methylphenyl)urea.
| Compound Name | 1-[4-(azepane-1-carbonyl)-1,3-thiazol-2-yl]-3-(3-methylphenyl)urea |
|---|---|
| PubChem CID | 16948435 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 1-[4-(azepane-1-carbonyl)-1,3-thiazol-2-yl]-3-(3-methylphenyl)urea |
| SMILES | Cc1cccc(NC(=O)Nc2nc(C(=O)N3CCCCCC3)cs2)c1 |
| InChI | InChI=1S/C18H22N4O2S/c1-13-7-6-8-14(11-13)19-17(24)21-18-20-15(12-25-18)16(23)22-9-4-2-3-5-10-22/h6-8,11-12H,2-5,9-10H2,1H3,(H2,19,20,21,24) |
| InChIKey | LLEILMWGLSAOHW-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |