C17H19N3O4S — CID 16915191
3,5-dimethoxy-N-[4-(pyrrolidine-1-carbonyl)-1,3-thiazol-2-yl]benzamide (PubChem CID 16915191) has the molecular formula C17H19N3O4S and a molecular weight of 361.42 g/mol. Its IUPAC name is 3,5-dimethoxy-N-[4-(pyrrolidine-1-carbonyl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 3,5-dimethoxy-N-[4-(pyrrolidine-1-carbonyl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 16915191 |
| Molecular Formula | C17H19N3O4S |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 3,5-dimethoxy-N-[4-(pyrrolidine-1-carbonyl)-1,3-thiazol-2-yl]benzamide |
| SMILES | COc1cc(OC)cc(C(=O)Nc2nc(C(=O)N3CCCC3)cs2)c1 |
| InChI | InChI=1S/C17H19N3O4S/c1-23-12-7-11(8-13(9-12)24-2)15(21)19-17-18-14(10-25-17)16(22)20-5-3-4-6-20/h7-10H,3-6H2,1-2H3,(H,18,19,21) |
| InChIKey | TWZNFIACOZXHNU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |