C10H17ClN4OS — CID 87173211
1-(4-methyl-1,3-thiazol-2-yl)-3-piperidin-3-ylurea;hydrochloride (PubChem CID 87173211) has the molecular formula C10H17ClN4OS and a molecular weight of 276.79 g/mol. Its IUPAC name is 1-(4-methyl-1,3-thiazol-2-yl)-3-piperidin-3-ylurea;hydrochloride.
| Compound Name | 1-(4-methyl-1,3-thiazol-2-yl)-3-piperidin-3-ylurea;hydrochloride |
|---|---|
| PubChem CID | 87173211 |
| Molecular Formula | C10H17ClN4OS |
| Molecular Weight | 276.79 g/mol |
| Exact Mass | 276.08 |
| IUPAC Name | 1-(4-methyl-1,3-thiazol-2-yl)-3-piperidin-3-ylurea;hydrochloride |
| SMILES | Cc1csc(NC(=O)NC2CCCNC2)n1.Cl |
| InChI | InChI=1S/C10H16N4OS.ClH/c1-7-6-16-10(12-7)14-9(15)13-8-3-2-4-11-5-8;/h6,8,11H,2-5H2,1H3,(H2,12,13,14,15);1H |
| InChIKey | PWNNKOOBZHHKEE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.79 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |