C16H22N2O6 — CID 174341375
(Z)-but-2-enedioic acid;N-pyridin-2-ylcyclohexanecarboxamide;hydrate (PubChem CID 174341375) has the molecular formula C16H22N2O6 and a molecular weight of 338.36 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;N-pyridin-2-ylcyclohexanecarboxamide;hydrate.
| Compound Name | (Z)-but-2-enedioic acid;N-pyridin-2-ylcyclohexanecarboxamide;hydrate |
|---|---|
| PubChem CID | 174341375 |
| Molecular Formula | C16H22N2O6 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | (Z)-but-2-enedioic acid;N-pyridin-2-ylcyclohexanecarboxamide;hydrate |
| SMILES | O.O=C(Nc1ccccn1)C1CCCCC1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C12H16N2O.C4H4O4.H2O/c15-12(10-6-2-1-3-7-10)14-11-8-4-5-9-13-11;5-3(6)1-2-4(7)8;/h4-5,8-10H,1-3,6-7H2,(H,13,14,15);1-2H,(H,5,6)(H,7,8);1H2/b;2-1-; |
| InChIKey | QGSHDCRODHUMNU-FJOGWHKWSA-N |
| XLogP | 1.49 |
| TPSA | 148.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|