C9H6ClF3N2O — CID 6361680
(E)-3-chloro-1,1,1-trifluoro-4-(pyridin-2-ylamino)but-3-en-2-one (PubChem CID 6361680) has the molecular formula C9H6ClF3N2O and a molecular weight of 250.61 g/mol. Its IUPAC name is (E)-3-chloro-1,1,1-trifluoro-4-(pyridin-2-ylamino)but-3-en-2-one.
| Compound Name | (E)-3-chloro-1,1,1-trifluoro-4-(pyridin-2-ylamino)but-3-en-2-one |
|---|---|
| PubChem CID | 6361680 |
| Molecular Formula | C9H6ClF3N2O |
| Molecular Weight | 250.61 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | (E)-3-chloro-1,1,1-trifluoro-4-(pyridin-2-ylamino)but-3-en-2-one |
| SMILES | O=C(/C(Cl)=C\Nc1ccccn1)C(F)(F)F |
| InChI | InChI=1S/C9H6ClF3N2O/c10-6(8(16)9(11,12)13)5-15-7-3-1-2-4-14-7/h1-5H,(H,14,15)/b6-5+ |
| InChIKey | TUGYNGFEQKMPND-AATRIKPKSA-N |
| XLogP | 2.71 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.61 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|