C19H16N2O4S2 — CID 15591383
N-[2,2-bis(benzenesulfonyl)ethenyl]pyridin-2-amine (PubChem CID 15591383) has the molecular formula C19H16N2O4S2 and a molecular weight of 400.48 g/mol. Its IUPAC name is N-[2,2-bis(benzenesulfonyl)ethenyl]pyridin-2-amine.
| Compound Name | N-[2,2-bis(benzenesulfonyl)ethenyl]pyridin-2-amine |
|---|---|
| PubChem CID | 15591383 |
| Molecular Formula | C19H16N2O4S2 |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | N-[2,2-bis(benzenesulfonyl)ethenyl]pyridin-2-amine |
| SMILES | O=S(=O)(C(=CNc1ccccn1)S(=O)(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H16N2O4S2/c22-26(23,16-9-3-1-4-10-16)19(15-21-18-13-7-8-14-20-18)27(24,25)17-11-5-2-6-12-17/h1-15H,(H,20,21) |
| InChIKey | XLTDKKOKERUEOF-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |