C19H14Cl2N2O4S2 — CID 15591431
N-[2,2-bis[(4-chlorophenyl)sulfonyl]ethenyl]pyridin-3-amine (PubChem CID 15591431) has the molecular formula C19H14Cl2N2O4S2 and a molecular weight of 469.37 g/mol. Its IUPAC name is N-[2,2-bis[(4-chlorophenyl)sulfonyl]ethenyl]pyridin-3-amine.
| Compound Name | N-[2,2-bis[(4-chlorophenyl)sulfonyl]ethenyl]pyridin-3-amine |
|---|---|
| PubChem CID | 15591431 |
| Molecular Formula | C19H14Cl2N2O4S2 |
| Molecular Weight | 469.37 g/mol |
| Exact Mass | 467.98 |
| IUPAC Name | N-[2,2-bis[(4-chlorophenyl)sulfonyl]ethenyl]pyridin-3-amine |
| SMILES | O=S(=O)(C(=CNc1cccnc1)S(=O)(=O)c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H14Cl2N2O4S2/c20-14-3-7-17(8-4-14)28(24,25)19(13-23-16-2-1-11-22-12-16)29(26,27)18-9-5-15(21)6-10-18/h1-13,23H |
| InChIKey | ULJOUYHFSGPFJP-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 93.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.37 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |