C10H9F3N2O — CID 7084676
(Z)-1,1,1-trifluoro-4-(pyridin-2-ylamino)pent-3-en-2-one (PubChem CID 7084676) has the molecular formula C10H9F3N2O and a molecular weight of 230.19 g/mol. Its IUPAC name is (Z)-1,1,1-trifluoro-4-(pyridin-2-ylamino)pent-3-en-2-one.
| Compound Name | (Z)-1,1,1-trifluoro-4-(pyridin-2-ylamino)pent-3-en-2-one |
|---|---|
| PubChem CID | 7084676 |
| Molecular Formula | C10H9F3N2O |
| Molecular Weight | 230.19 g/mol |
| Exact Mass | 230.07 |
| IUPAC Name | (Z)-1,1,1-trifluoro-4-(pyridin-2-ylamino)pent-3-en-2-one |
| SMILES | C/C(=C/C(=O)C(F)(F)F)Nc1ccccn1 |
| InChI | InChI=1S/C10H9F3N2O/c1-7(6-8(16)10(11,12)13)15-9-4-2-3-5-14-9/h2-6H,1H3,(H,14,15)/b7-6- |
| InChIKey | JSLJKBSJTRVYDI-SREVYHEPSA-N |
| XLogP | 2.53 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.19 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|