About methyl 2-[[(Z)-5,5,5-trifluoro-4-oxopent-2-en-2-yl]amino]pyridine-3-carboxylate
methyl 2-[[(Z)-5,5,5-trifluoro-4-oxopent-2-en-2-yl]amino]pyridine-3-carboxylate (PubChem CID 11673668) has the molecular formula C12H11F3N2O3
and a molecular weight of 288.23 g/mol. Its IUPAC name is methyl 2-[[(Z)-5,5,5-trifluoro-4-oxopent-2-en-2-yl]amino]pyridine-3-carboxylate.
Molecular Properties
| Compound Name | methyl 2-[[(Z)-5,5,5-trifluoro-4-oxopent-2-en-2-yl]amino]pyridine-3-carboxylate |
| PubChem CID | 11673668 |
| Molecular Formula | C12H11F3N2O3 |
| Molecular Weight | 288.23 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | methyl 2-[[(Z)-5,5,5-trifluoro-4-oxopent-2-en-2-yl]amino]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cccnc1N/C(C)=C\C(=O)C(F)(F)F |
| InChI | InChI=1S/C12H11F3N2O3/c1-7(6-9(18)12(13,14)15)17-10-8(11(19)20-2)4-3-5-16-10/h3-6H,1-2H3,(H,16,17)/b7-6- |
| InChIKey | XSSLGEVYWIJDCE-SREVYHEPSA-N |
| XLogP | 2.32 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.23 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-[[(Z)-5,5,5-trifluoro-4-oxopent-2-en-2-yl]amino]pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-[[(Z)-5,5,5-trifluoro-4-oxopent-2-en-2-yl]amino]pyridine-3-carboxylate?
The IUPAC name of methyl 2-[[(Z)-5,5,5-trifluoro-4-oxopent-2-en-2-yl]amino]pyridine-3-carboxylate (CID 11673668) is methyl 2-[[(Z)-5,5,5-trifluoro-4-oxopent-2-en-2-yl]amino]pyridine-3-carboxylate.
What is the SMILES notation for methyl 2-[[(Z)-5,5,5-trifluoro-4-oxopent-2-en-2-yl]amino]pyridine-3-carboxylate?
The canonical SMILES for methyl 2-[[(Z)-5,5,5-trifluoro-4-oxopent-2-en-2-yl]amino]pyridine-3-carboxylate is COC(=O)c1cccnc1N/C(C)=C\C(=O)C(F)(F)F.
What is the InChIKey of methyl 2-[[(Z)-5,5,5-trifluoro-4-oxopent-2-en-2-yl]amino]pyridine-3-carboxylate?
The InChIKey is XSSLGEVYWIJDCE-SREVYHEPSA-N. The full InChI is InChI=1S/C12H11F3N2O3/c1-7(6-9(18)12(13,14)15)17-10-8(11(19)20-2)4-3-5-16-10/h3-6H,1-2H3,(H,16,17)/b7-6-.
What are the key properties of methyl 2-[[(Z)-5,5,5-trifluoro-4-oxopent-2-en-2-yl]amino]pyridine-3-carboxylate?
methyl 2-[[(Z)-5,5,5-trifluoro-4-oxopent-2-en-2-yl]amino]pyridine-3-carboxylate has a molecular weight of 288.23 g/mol, XLogP of 2.32, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-[[(Z)-5,5,5-trifluoro-4-oxopent-2-en-2-yl]amino]pyridine-3-carboxylate is sourced from PubChem (CID 11673668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).