C13H13F3N2O2 — CID 162577082
2-[[(2E,4E)-6,6,6-trifluoro-5-methylhexa-2,4-dien-3-yl]amino]pyridine-3-carboxylic acid (PubChem CID 162577082) has the molecular formula C13H13F3N2O2 and a molecular weight of 286.25 g/mol. Its IUPAC name is 2-[[(2E,4E)-6,6,6-trifluoro-5-methylhexa-2,4-dien-3-yl]amino]pyridine-3-carboxylic acid.
| Compound Name | 2-[[(2E,4E)-6,6,6-trifluoro-5-methylhexa-2,4-dien-3-yl]amino]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 162577082 |
| Molecular Formula | C13H13F3N2O2 |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | 2-[[(2E,4E)-6,6,6-trifluoro-5-methylhexa-2,4-dien-3-yl]amino]pyridine-3-carboxylic acid |
| SMILES | C/C=C(\C=C(/C)C(F)(F)F)Nc1ncccc1C(=O)O |
| InChI | InChI=1S/C13H13F3N2O2/c1-3-9(7-8(2)13(14,15)16)18-11-10(12(19)20)5-4-6-17-11/h3-7H,1-2H3,(H,17,18)(H,19,20)/b8-7+,9-3+ |
| InChIKey | UPKKZUAGVFLLEV-JFZQOVMVSA-N |
| XLogP | 3.60 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|