C20H16N4O — CID 108818132
(Z)-N-(4-aminophenyl)-2-cyano-3-(naphthalen-2-ylamino)prop-2-enamide (PubChem CID 108818132) has the molecular formula C20H16N4O and a molecular weight of 328.38 g/mol. Its IUPAC name is (Z)-N-(4-aminophenyl)-2-cyano-3-(naphthalen-2-ylamino)prop-2-enamide.
| Compound Name | (Z)-N-(4-aminophenyl)-2-cyano-3-(naphthalen-2-ylamino)prop-2-enamide |
|---|---|
| PubChem CID | 108818132 |
| Molecular Formula | C20H16N4O |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.13 |
| IUPAC Name | (Z)-N-(4-aminophenyl)-2-cyano-3-(naphthalen-2-ylamino)prop-2-enamide |
| SMILES | N#C/C(=C/Nc1ccc2ccccc2c1)C(=O)Nc1ccc(N)cc1 |
| InChI | InChI=1S/C20H16N4O/c21-12-16(20(25)24-18-9-6-17(22)7-10-18)13-23-19-8-5-14-3-1-2-4-15(14)11-19/h1-11,13,23H,22H2,(H,24,25)/b16-13- |
| InChIKey | ZACMFNVBTINWEO-SSZFMOIBSA-N |
| XLogP | 3.88 |
| TPSA | 90.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|