C17H16N4O2 — CID 108818080
(Z)-N-(4-aminophenyl)-2-cyano-3-(2-hydroxy-5-methylanilino)prop-2-enamide (PubChem CID 108818080) has the molecular formula C17H16N4O2 and a molecular weight of 308.34 g/mol. Its IUPAC name is (Z)-N-(4-aminophenyl)-2-cyano-3-(2-hydroxy-5-methylanilino)prop-2-enamide.
| Compound Name | (Z)-N-(4-aminophenyl)-2-cyano-3-(2-hydroxy-5-methylanilino)prop-2-enamide |
|---|---|
| PubChem CID | 108818080 |
| Molecular Formula | C17H16N4O2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | (Z)-N-(4-aminophenyl)-2-cyano-3-(2-hydroxy-5-methylanilino)prop-2-enamide |
| SMILES | Cc1ccc(O)c(N/C=C(/C#N)C(=O)Nc2ccc(N)cc2)c1 |
| InChI | InChI=1S/C17H16N4O2/c1-11-2-7-16(22)15(8-11)20-10-12(9-18)17(23)21-14-5-3-13(19)4-6-14/h2-8,10,20,22H,19H2,1H3,(H,21,23)/b12-10- |
| InChIKey | XWZPTMAZXWKPED-BENRWUELSA-N |
| XLogP | 2.74 |
| TPSA | 111.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|